C25H28O6S — CID 118672450
(3Z,5Z)-3-[[3-(hydroxymethyl)-2-methoxy-4-methylphenyl]methylidene]-5-[(2,3,4-trimethoxyphenyl)methylidene]thian-4-one (PubChem CID 118672450) has the molecular formula C25H28O6S and a molecular weight of 456.56 g/mol. Its IUPAC name is (3Z,5Z)-3-[[3-(hydroxymethyl)-2-methoxy-4-methylphenyl]methylidene]-5-[(2,3,4-trimethoxyphenyl)methylidene]thian-4-one.
| Compound Name | (3Z,5Z)-3-[[3-(hydroxymethyl)-2-methoxy-4-methylphenyl]methylidene]-5-[(2,3,4-trimethoxyphenyl)methylidene]thian-4-one |
|---|---|
| PubChem CID | 118672450 |
| Molecular Formula | C25H28O6S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (3Z,5Z)-3-[[3-(hydroxymethyl)-2-methoxy-4-methylphenyl]methylidene]-5-[(2,3,4-trimethoxyphenyl)methylidene]thian-4-one |
| SMILES | COc1ccc(/C=C2\CSC/C(=C\c3ccc(C)c(CO)c3OC)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C25H28O6S/c1-15-6-7-16(23(29-3)20(15)12-26)10-18-13-32-14-19(22(18)27)11-17-8-9-21(28-2)25(31-5)24(17)30-4/h6-11,26H,12-14H2,1-5H3/b18-10+,19-11+ |
| InChIKey | XIRAORPCUFBTLN-XOBNHNQQSA-N |
| XLogP | 4.30 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|