C32H33BrFNO7 — CID 72712439
(3E,5E)-1-[(4-bromo-2-fluorophenyl)methyl]-3,5-bis[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one (PubChem CID 72712439) has the molecular formula C32H33BrFNO7 and a molecular weight of 642.52 g/mol. Its IUPAC name is (3E,5E)-1-[(4-bromo-2-fluorophenyl)methyl]-3,5-bis[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-[(4-bromo-2-fluorophenyl)methyl]-3,5-bis[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 72712439 |
| Molecular Formula | C32H33BrFNO7 |
| Molecular Weight | 642.52 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | (3E,5E)-1-[(4-bromo-2-fluorophenyl)methyl]-3,5-bis[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1ccc(/C=C2\CN(Cc3ccc(Br)cc3F)C/C(=C\c3ccc(OC)c(OC)c3OC)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C32H33BrFNO7/c1-37-26-11-8-19(29(39-3)31(26)41-5)13-22-17-35(16-21-7-10-24(33)15-25(21)34)18-23(28(22)36)14-20-9-12-27(38-2)32(42-6)30(20)40-4/h7-15H,16-18H2,1-6H3/b22-13+,23-14+ |
| InChIKey | ATMUIWAHPRZFMU-MSKUYSOUSA-N |
| XLogP | 6.19 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|