C14H18O4 — CID 73015707
3-methyl-4-(2,3,4-trimethoxyphenyl)but-3-en-2-one (PubChem CID 73015707) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-methyl-4-(2,3,4-trimethoxyphenyl)but-3-en-2-one.
| Compound Name | 3-methyl-4-(2,3,4-trimethoxyphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 73015707 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-methyl-4-(2,3,4-trimethoxyphenyl)but-3-en-2-one |
| SMILES | COc1ccc(C=C(C)C(C)=O)c(OC)c1OC |
| InChI | InChI=1S/C14H18O4/c1-9(10(2)15)8-11-6-7-12(16-3)14(18-5)13(11)17-4/h6-8H,1-5H3 |
| InChIKey | HNZGFXLKVQYMKN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|