C21H23NO6 — CID 59044578
(E)-2,3-bis(2,3,4-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 59044578) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (E)-2,3-bis(2,3,4-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2,3-bis(2,3,4-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 59044578 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (E)-2,3-bis(2,3,4-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2ccc(OC)c(OC)c2OC)c(OC)c1OC |
| InChI | InChI=1S/C21H23NO6/c1-23-16-9-7-13(18(25-3)20(16)27-5)11-14(12-22)15-8-10-17(24-2)21(28-6)19(15)26-4/h7-11H,1-6H3/b14-11- |
| InChIKey | QFNIRZADHDNJSW-KAMYIIQDSA-N |
| XLogP | 3.80 |
| TPSA | 79.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|