C16H15NO3S — CID 70281149
(E)-2-thiophen-3-yl-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 70281149) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (E)-2-thiophen-3-yl-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-thiophen-3-yl-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 70281149 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (E)-2-thiophen-3-yl-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2ccsc2)c(OC)c1OC |
| InChI | InChI=1S/C16H15NO3S/c1-18-14-5-4-11(15(19-2)16(14)20-3)8-13(9-17)12-6-7-21-10-12/h4-8,10H,1-3H3/b13-8- |
| InChIKey | JDBJHXRWDXNJHY-JYRVWZFOSA-N |
| XLogP | 3.84 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|