C12H15NO5 — CID 6537121
1,2,3-trimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene (PubChem CID 6537121) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene.
| Compound Name | 1,2,3-trimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 6537121 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1,2,3-trimethoxy-4-[(E)-2-nitroprop-1-enyl]benzene |
| SMILES | COc1ccc(/C=C(\C)[N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C12H15NO5/c1-8(13(14)15)7-9-5-6-10(16-2)12(18-4)11(9)17-3/h5-7H,1-4H3/b8-7+ |
| InChIKey | OWNHUMYJCSEOTJ-BQYQJAHWSA-N |
| XLogP | 2.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|