C14H19BrO3 — CID 79324290
1-[2-(bromomethyl)but-1-enyl]-2,3,4-trimethoxybenzene (PubChem CID 79324290) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is 1-[2-(bromomethyl)but-1-enyl]-2,3,4-trimethoxybenzene.
| Compound Name | 1-[2-(bromomethyl)but-1-enyl]-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 79324290 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-[2-(bromomethyl)but-1-enyl]-2,3,4-trimethoxybenzene |
| SMILES | CCC(=Cc1ccc(OC)c(OC)c1OC)CBr |
| InChI | InChI=1S/C14H19BrO3/c1-5-10(9-15)8-11-6-7-12(16-2)14(18-4)13(11)17-3/h6-8H,5,9H2,1-4H3 |
| InChIKey | NOGPGTWZHLTWHF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|