C13H10Br2O — CID 154991789
1-(2,2-dibromoethenyl)-4-methoxynaphthalene (PubChem CID 154991789) has the molecular formula C13H10Br2O and a molecular weight of 342.03 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)-4-methoxynaphthalene.
| Compound Name | 1-(2,2-dibromoethenyl)-4-methoxynaphthalene |
|---|---|
| PubChem CID | 154991789 |
| Molecular Formula | C13H10Br2O |
| Molecular Weight | 342.03 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | 1-(2,2-dibromoethenyl)-4-methoxynaphthalene |
| SMILES | COc1ccc(C=C(Br)Br)c2ccccc12 |
| InChI | InChI=1S/C13H10Br2O/c1-16-12-7-6-9(8-13(14)15)10-4-2-3-5-11(10)12/h2-8H,1H3 |
| InChIKey | WLGIYMJCLXUEET-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |