C16H13NO3 — CID 71193014
(3E)-3-[(4-methoxynaphthalen-1-yl)methylidene]pyrrolidine-2,5-dione (PubChem CID 71193014) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is (3E)-3-[(4-methoxynaphthalen-1-yl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[(4-methoxynaphthalen-1-yl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71193014 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (3E)-3-[(4-methoxynaphthalen-1-yl)methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(/C=C2\CC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C16H13NO3/c1-20-14-7-6-10(12-4-2-3-5-13(12)14)8-11-9-15(18)17-16(11)19/h2-8H,9H2,1H3,(H,17,18,19)/b11-8+ |
| InChIKey | AWRCXKZOQMLJHU-DHZHZOJOSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|