C24H22N2O6 — CID 160654115
(3E)-3-[(4-methoxyphenyl)methylidene]pyrrolidine-2,5-dione (PubChem CID 160654115) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (3E)-3-[(4-methoxyphenyl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[(4-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 160654115 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (3E)-3-[(4-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(/C=C2\CC(=O)NC2=O)cc1.COc1ccc(/C=C2\CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/2C12H11NO3/c2*1-16-10-4-2-8(3-5-10)6-9-7-11(14)13-12(9)15/h2*2-6H,7H2,1H3,(H,13,14,15)/b2*9-6+ |
| InChIKey | RKUWQRVGLOOOSL-ACOOBTJJSA-N |
| XLogP | 2.25 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|