C14H15NO2 — CID 174799833
3-[(4-methoxyphenyl)methylidene]-5-methylidenepiperidin-4-one (PubChem CID 174799833) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methylidene]-5-methylidenepiperidin-4-one.
| Compound Name | 3-[(4-methoxyphenyl)methylidene]-5-methylidenepiperidin-4-one |
|---|---|
| PubChem CID | 174799833 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-[(4-methoxyphenyl)methylidene]-5-methylidenepiperidin-4-one |
| SMILES | C=C1CNCC(=Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C14H15NO2/c1-10-8-15-9-12(14(10)16)7-11-3-5-13(17-2)6-4-11/h3-7,15H,1,8-9H2,2H3 |
| InChIKey | YGVHPUINPPWHLG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|