C24H24O5 — CID 11101254
[(3E,5E)-3,5-bis[(4-methoxyphenyl)methylidene]-4-oxocyclohexyl] acetate (PubChem CID 11101254) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(3E,5E)-3,5-bis[(4-methoxyphenyl)methylidene]-4-oxocyclohexyl] acetate.
| Compound Name | [(3E,5E)-3,5-bis[(4-methoxyphenyl)methylidene]-4-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 11101254 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(3E,5E)-3,5-bis[(4-methoxyphenyl)methylidene]-4-oxocyclohexyl] acetate |
| SMILES | COc1ccc(/C=C2\CC(OC(C)=O)C/C(=C\c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H24O5/c1-16(25)29-23-14-19(12-17-4-8-21(27-2)9-5-17)24(26)20(15-23)13-18-6-10-22(28-3)11-7-18/h4-13,23H,14-15H2,1-3H3/b19-12+,20-13+ |
| InChIKey | AKGYIEGKWFKVSZ-KVOOEGMKSA-N |
| XLogP | 4.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|