C11H9NO3Se — CID 6447629
(5E)-5-[(4-methoxyphenyl)methylidene]-1,3-selenazolidine-2,4-dione (PubChem CID 6447629) has the molecular formula C11H9NO3Se and a molecular weight of 282.16 g/mol. Its IUPAC name is (5E)-5-[(4-methoxyphenyl)methylidene]-1,3-selenazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-methoxyphenyl)methylidene]-1,3-selenazolidine-2,4-dione |
|---|---|
| PubChem CID | 6447629 |
| Molecular Formula | C11H9NO3Se |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | (5E)-5-[(4-methoxyphenyl)methylidene]-1,3-selenazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2/[Se]C(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H9NO3Se/c1-15-8-4-2-7(3-5-8)6-9-10(13)12-11(14)16-9/h2-6H,1H3,(H,12,13,14)/b9-6+ |
| InChIKey | WECUPWYURSALGJ-RMKNXTFCSA-N |
| XLogP | 0.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|