C13H14N2O3 — CID 905014
(6R)-3-[(4-methoxyphenyl)methylidene]-6-methylpiperazine-2,5-dione (PubChem CID 905014) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (6R)-3-[(4-methoxyphenyl)methylidene]-6-methylpiperazine-2,5-dione.
| Compound Name | (6R)-3-[(4-methoxyphenyl)methylidene]-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 905014 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (6R)-3-[(4-methoxyphenyl)methylidene]-6-methylpiperazine-2,5-dione |
| SMILES | COc1ccc(C=C2NC(=O)[C@@H](C)NC2=O)cc1 |
| InChI | InChI=1S/C13H14N2O3/c1-8-12(16)15-11(13(17)14-8)7-9-3-5-10(18-2)6-4-9/h3-8H,1-2H3,(H,14,17)(H,15,16)/t8-/m1/s1 |
| InChIKey | CHNKTBHDSKNMAO-MRVPVSSYSA-N |
| XLogP | 0.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|