C19H19N3O4 — CID 67614037
3-[(4-hydroxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylamino]piperazine-2,5-dione (PubChem CID 67614037) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylamino]piperazine-2,5-dione.
| Compound Name | 3-[(4-hydroxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylamino]piperazine-2,5-dione |
|---|---|
| PubChem CID | 67614037 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylamino]piperazine-2,5-dione |
| SMILES | COc1ccc(CNC2NC(=O)C(=Cc3ccc(O)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-26-15-8-4-13(5-9-15)11-20-17-19(25)21-16(18(24)22-17)10-12-2-6-14(23)7-3-12/h2-10,17,20,23H,11H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | KZQRQJWQJWHTIC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|