C12H12N2O2 — CID 136893825
(4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1H-imidazol-5-one (PubChem CID 136893825) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893825 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1H-imidazol-5-one |
| SMILES | COc1ccc(/C=C2/N=C(C)NC2=O)cc1 |
| InChI | InChI=1S/C12H12N2O2/c1-8-13-11(12(15)14-8)7-9-3-5-10(16-2)6-4-9/h3-7H,1-2H3,(H,13,14,15)/b11-7+ |
| InChIKey | AJAOJNAMINQHIA-YRNVUSSQSA-N |
| XLogP | 1.58 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|