C23H23Cl2NO5 — CID 127030363
(3E,5E)-3,5-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]piperidin-4-one (PubChem CID 127030363) has the molecular formula C23H23Cl2NO5 and a molecular weight of 464.35 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 127030363 |
| Molecular Formula | C23H23Cl2NO5 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (3E,5E)-3,5-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1ccc(/C=C2\CNC/C(=C\c3ccc(OC)c(OC)c3Cl)C2=O)c(Cl)c1OC |
| InChI | InChI=1S/C23H23Cl2NO5/c1-28-17-7-5-13(19(24)22(17)30-3)9-15-11-26-12-16(21(15)27)10-14-6-8-18(29-2)23(31-4)20(14)25/h5-10,26H,11-12H2,1-4H3/b15-9+,16-10+ |
| InChIKey | ZPGLTKZQGIBQNR-KAVGSWPWSA-N |
| XLogP | 4.67 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|