C19H19ClO3 — CID 141458819
2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3,4,4a,5-tetrahydronaphthalen-1-one (PubChem CID 141458819) has the molecular formula C19H19ClO3 and a molecular weight of 330.81 g/mol. Its IUPAC name is 2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3,4,4a,5-tetrahydronaphthalen-1-one.
| Compound Name | 2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3,4,4a,5-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 141458819 |
| Molecular Formula | C19H19ClO3 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3,4,4a,5-tetrahydronaphthalen-1-one |
| SMILES | COc1ccc(C=C2CCC3CC=CC=C3C2=O)c(Cl)c1OC |
| InChI | InChI=1S/C19H19ClO3/c1-22-16-10-9-13(17(20)19(16)23-2)11-14-8-7-12-5-3-4-6-15(12)18(14)21/h3-4,6,9-12H,5,7-8H2,1-2H3 |
| InChIKey | UDKRCNIBAYBOCI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|