About 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one
2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one (PubChem CID 141458772) has the molecular formula C27H30Cl2O5
and a molecular weight of 505.44 g/mol. Its IUPAC name is 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one |
| PubChem CID | 141458772 |
| Molecular Formula | C27H30Cl2O5 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one |
| SMILES | COc1ccc(C=C2CC(C(C)C)CC(=Cc3ccc(OC)c(OC)c3Cl)C2=O)c(Cl)c1OC |
| InChI | InChI=1S/C27H30Cl2O5/c1-15(2)18-13-19(11-16-7-9-21(31-3)26(33-5)23(16)28)25(30)20(14-18)12-17-8-10-22(32-4)27(34-6)24(17)29/h7-12,15,18H,13-14H2,1-6H3 |
| InChIKey | WVEFETMAQSNUPL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one?
The IUPAC name of 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one (CID 141458772) is 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one.
What is the SMILES notation for 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one?
The canonical SMILES for 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one is COc1ccc(C=C2CC(C(C)C)CC(=Cc3ccc(OC)c(OC)c3Cl)C2=O)c(Cl)c1OC.
What is the InChIKey of 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one?
The InChIKey is WVEFETMAQSNUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30Cl2O5/c1-15(2)18-13-19(11-16-7-9-21(31-3)26(33-5)23(16)28)25(30)20(14-18)12-17-8-10-22(32-4)27(34-6)24(17)29/h7-12,15,18H,13-14H2,1-6H3.
What are the key properties of 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one?
2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one has a molecular weight of 505.44 g/mol, XLogP of 7.13, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[(2-chloro-3,4-dimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one is sourced from PubChem (CID 141458772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).