C11H12Cl2O2 — CID 79335637
2-chloro-1-(3-chloroprop-1-enyl)-3,4-dimethoxybenzene (PubChem CID 79335637) has the molecular formula C11H12Cl2O2 and a molecular weight of 247.12 g/mol. Its IUPAC name is 2-chloro-1-(3-chloroprop-1-enyl)-3,4-dimethoxybenzene.
| Compound Name | 2-chloro-1-(3-chloroprop-1-enyl)-3,4-dimethoxybenzene |
|---|---|
| PubChem CID | 79335637 |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-chloro-1-(3-chloroprop-1-enyl)-3,4-dimethoxybenzene |
| SMILES | COc1ccc(C=CCCl)c(Cl)c1OC |
| InChI | InChI=1S/C11H12Cl2O2/c1-14-9-6-5-8(4-3-7-12)10(13)11(9)15-2/h3-6H,7H2,1-2H3 |
| InChIKey | XDLUATPHHYNZIZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|