C20H27ClN2O3 — CID 21031148
(E)-3-(2-chloro-3,4-dimethoxyphenyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 21031148) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is (E)-3-(2-chloro-3,4-dimethoxyphenyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloro-3,4-dimethoxyphenyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 21031148 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (E)-3-(2-chloro-3,4-dimethoxyphenyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC(N3CCCC3)CC2)c(Cl)c1OC |
| InChI | InChI=1S/C20H27ClN2O3/c1-25-17-7-5-15(19(21)20(17)26-2)6-8-18(24)23-13-9-16(10-14-23)22-11-3-4-12-22/h5-8,16H,3-4,9-14H2,1-2H3/b8-6+ |
| InChIKey | CFBRRVGOQVDVBK-SOFGYWHQSA-N |
| XLogP | 3.46 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|