C19H22Cl2N2O5 — CID 11697646
2-[[1-[(E)-3-(2,3-dichloro-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid (PubChem CID 11697646) has the molecular formula C19H22Cl2N2O5 and a molecular weight of 429.30 g/mol. Its IUPAC name is 2-[[1-[(E)-3-(2,3-dichloro-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[1-[(E)-3-(2,3-dichloro-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11697646 |
| Molecular Formula | C19H22Cl2N2O5 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[[1-[(E)-3-(2,3-dichloro-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC(C(=O)NC(C)C(=O)O)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C19H22Cl2N2O5/c1-11(19(26)27)22-18(25)13-7-9-23(10-8-13)15(24)6-4-12-3-5-14(28-2)17(21)16(12)20/h3-6,11,13H,7-10H2,1-2H3,(H,22,25)(H,26,27)/b6-4+ |
| InChIKey | XMCZYJYPJSYBTJ-GQCTYLIASA-N |
| XLogP | 2.84 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|