C21H26Cl2N2O4S — CID 11655826
2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 11655826) has the molecular formula C21H26Cl2N2O4S and a molecular weight of 473.42 g/mol. Its IUPAC name is 2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11655826 |
| Molecular Formula | C21H26Cl2N2O4S |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CSc1ccc(/C=C/C(=O)N2CCC(C(=O)NC(C(=O)O)C(C)C)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C21H26Cl2N2O4S/c1-12(2)19(21(28)29)24-20(27)14-8-10-25(11-9-14)16(26)7-5-13-4-6-15(30-3)18(23)17(13)22/h4-7,12,14,19H,8-11H2,1-3H3,(H,24,27)(H,28,29)/b7-5+ |
| InChIKey | LTBDNPCICYYOHB-FNORWQNLSA-N |
| XLogP | 4.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|