C22H30Cl2N2O4S — CID 163473563
1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]-N-[(2S,3S)-1,1-dihydroxy-3-methylpentan-2-yl]piperidine-4-carboxamide (PubChem CID 163473563) has the molecular formula C22H30Cl2N2O4S and a molecular weight of 489.47 g/mol. Its IUPAC name is 1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]-N-[(2S,3S)-1,1-dihydroxy-3-methylpentan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]-N-[(2S,3S)-1,1-dihydroxy-3-methylpentan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 163473563 |
| Molecular Formula | C22H30Cl2N2O4S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]-N-[(2S,3S)-1,1-dihydroxy-3-methylpentan-2-yl]piperidine-4-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)C1CCN(C(=O)/C=C/c2ccc(SC)c(Cl)c2Cl)CC1)C(O)O |
| InChI | InChI=1S/C22H30Cl2N2O4S/c1-4-13(2)20(22(29)30)25-21(28)15-9-11-26(12-10-15)17(27)8-6-14-5-7-16(31-3)19(24)18(14)23/h5-8,13,15,20,22,29-30H,4,9-12H2,1-3H3,(H,25,28)/b8-6+/t13-,20-/m0/s1 |
| InChIKey | BYORZUQZMIUOHD-FASZTBRTSA-N |
| XLogP | 3.81 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|