C19H22Cl2N2O6S — CID 11677290
2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfonylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid (PubChem CID 11677290) has the molecular formula C19H22Cl2N2O6S and a molecular weight of 477.37 g/mol. Its IUPAC name is 2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfonylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfonylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11677290 |
| Molecular Formula | C19H22Cl2N2O6S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfonylphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C1CCN(C(=O)/C=C/c2ccc(S(C)(=O)=O)c(Cl)c2Cl)CC1)C(=O)O |
| InChI | InChI=1S/C19H22Cl2N2O6S/c1-11(19(26)27)22-18(25)13-7-9-23(10-8-13)15(24)6-4-12-3-5-14(30(2,28)29)17(21)16(12)20/h3-6,11,13H,7-10H2,1-2H3,(H,22,25)(H,26,27)/b6-4+ |
| InChIKey | CBMLPSXGHZBEPP-GQCTYLIASA-N |
| XLogP | 2.24 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|