C20H26N4O6 — CID 11668883
2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid (PubChem CID 11668883) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11668883 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C1CCN(C(=O)/C=C/c2ccc(N(C)C)c([N+](=O)[O-])c2)CC1)C(=O)O |
| InChI | InChI=1S/C20H26N4O6/c1-13(20(27)28)21-19(26)15-8-10-23(11-9-15)18(25)7-5-14-4-6-16(22(2)3)17(12-14)24(29)30/h4-7,12-13,15H,8-11H2,1-3H3,(H,21,26)(H,27,28)/b7-5+ |
| InChIKey | SCZNYGXKCRWCQJ-FNORWQNLSA-N |
| XLogP | 1.50 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|