C21H28N4O6 — CID 143005592
methyl (2S)-2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate (PubChem CID 143005592) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 143005592 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl (2S)-2-[[1-[(E)-3-[4-(dimethylamino)-3-nitrophenyl]prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C1CCN(C(=O)/C=C/c2ccc(N(C)C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H28N4O6/c1-14(21(28)31-4)22-20(27)16-9-11-24(12-10-16)19(26)8-6-15-5-7-17(23(2)3)18(13-15)25(29)30/h5-8,13-14,16H,9-12H2,1-4H3,(H,22,27)/b8-6+/t14-/m0/s1 |
| InChIKey | NGNVBEDVQRPLOI-OWNNVSBGSA-N |
| XLogP | 1.59 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|