C21H22Cl2N2O4S — CID 143005546
methyl (2S)-2-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate (PubChem CID 143005546) has the molecular formula C21H22Cl2N2O4S and a molecular weight of 469.39 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 143005546 |
| Molecular Formula | C21H22Cl2N2O4S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | methyl (2S)-2-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C1CCN(C(=O)/C=C/c2cc3ccsc3c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O4S/c1-12(21(28)29-2)24-20(27)13-5-8-25(9-6-13)16(26)4-3-14-11-15-7-10-30-19(15)18(23)17(14)22/h3-4,7,10-13H,5-6,8-9H2,1-2H3,(H,24,27)/b4-3+/t12-/m0/s1 |
| InChIKey | ZZQMIITVJCCZQC-PCAWENJQSA-N |
| XLogP | 4.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|