C35H32Cl2N2O4S — CID 143008755
9H-fluoren-9-ylmethyl (3S)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-3-methyl-4-oxobutanoate (PubChem CID 143008755) has the molecular formula C35H32Cl2N2O4S and a molecular weight of 647.62 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3S)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-3-methyl-4-oxobutanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (3S)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 143008755 |
| Molecular Formula | C35H32Cl2N2O4S |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3S)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-3-methyl-4-oxobutanoate |
| SMILES | C[C@@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1CCN(C(=O)/C=C/c2cc3ccsc3c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C35H32Cl2N2O4S/c1-21(18-31(41)43-20-29-27-8-4-2-6-25(27)26-7-3-5-9-28(26)29)35(42)38-24-12-15-39(16-13-24)30(40)11-10-22-19-23-14-17-44-34(23)33(37)32(22)36/h2-11,14,17,19,21,24,29H,12-13,15-16,18,20H2,1H3,(H,38,42)/b11-10+/t21-/m0/s1 |
| InChIKey | SGZNZUNVHHEFJP-ZJVMWOEPSA-N |
| XLogP | 7.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|