C21H22Cl2N2O4S — CID 11669979
(2R)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-2-methyl-4-oxobutanoic acid (PubChem CID 11669979) has the molecular formula C21H22Cl2N2O4S and a molecular weight of 469.39 g/mol. Its IUPAC name is (2R)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-2-methyl-4-oxobutanoic acid.
| Compound Name | (2R)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11669979 |
| Molecular Formula | C21H22Cl2N2O4S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | (2R)-4-[[1-[(E)-3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-2-methyl-4-oxobutanoic acid |
| SMILES | C[C@H](CC(=O)NC1CCN(C(=O)/C=C/c2cc3ccsc3c(Cl)c2Cl)CC1)C(=O)O |
| InChI | InChI=1S/C21H22Cl2N2O4S/c1-12(21(28)29)10-16(26)24-15-4-7-25(8-5-15)17(27)3-2-13-11-14-6-9-30-20(14)19(23)18(13)22/h2-3,6,9,11-12,15H,4-5,7-8,10H2,1H3,(H,24,26)(H,28,29)/b3-2+/t12-/m1/s1 |
| InChIKey | LMVVZYIUNIQSCW-QAVQXKDTSA-N |
| XLogP | 4.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|