C20H24Cl2N2O5 — CID 70339361
(2S)-2-[[1-[(E)-3-(2,3-dichloro-4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid (PubChem CID 70339361) has the molecular formula C20H24Cl2N2O5 and a molecular weight of 443.33 g/mol. Its IUPAC name is (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70339361 |
| Molecular Formula | C20H24Cl2N2O5 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carbonyl]amino]propanoic acid |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCC(C(=O)N[C@@H](C)C(=O)O)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C20H24Cl2N2O5/c1-3-29-15-6-4-13(17(21)18(15)22)5-7-16(25)24-10-8-14(9-11-24)19(26)23-12(2)20(27)28/h4-7,12,14H,3,8-11H2,1-2H3,(H,23,26)(H,27,28)/b7-5+/t12-/m0/s1 |
| InChIKey | CQVWKWVOWAGGGY-PZBABLGHSA-N |
| XLogP | 3.23 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|