C27H25Cl2N3O5S — CID 90929839
2-benzamido-4-[[1-[3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-4-oxobutanoic acid (PubChem CID 90929839) has the molecular formula C27H25Cl2N3O5S and a molecular weight of 574.49 g/mol. Its IUPAC name is 2-benzamido-4-[[1-[3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-4-oxobutanoic acid.
| Compound Name | 2-benzamido-4-[[1-[3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90929839 |
| Molecular Formula | C27H25Cl2N3O5S |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | 2-benzamido-4-[[1-[3-(6,7-dichloro-1-benzothiophen-5-yl)prop-2-enoyl]piperidin-4-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(CC(NC(=O)c1ccccc1)C(=O)O)NC1CCN(C(=O)C=Cc2cc3ccsc3c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C27H25Cl2N3O5S/c28-23-17(14-18-10-13-38-25(18)24(23)29)6-7-22(34)32-11-8-19(9-12-32)30-21(33)15-20(27(36)37)31-26(35)16-4-2-1-3-5-16/h1-7,10,13-14,19-20H,8-9,11-12,15H2,(H,30,33)(H,31,35)(H,36,37) |
| InChIKey | BTPAKZDSPGDIRW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|