C31H30Cl2N2O5S — CID 73039575
4-[[1-[3-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-4-oxo-2-phenylbutanoic acid (PubChem CID 73039575) has the molecular formula C31H30Cl2N2O5S and a molecular weight of 613.56 g/mol. Its IUPAC name is 4-[[1-[3-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-4-oxo-2-phenylbutanoic acid.
| Compound Name | 4-[[1-[3-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 73039575 |
| Molecular Formula | C31H30Cl2N2O5S |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 4-[[1-[3-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-4-oxo-2-phenylbutanoic acid |
| SMILES | COc1ccccc1Sc1ccc(C=CC(=O)N2CCC(NC(=O)CC(C(=O)O)c3ccccc3)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C31H30Cl2N2O5S/c1-40-24-9-5-6-10-25(24)41-26-13-11-21(29(32)30(26)33)12-14-28(37)35-17-15-22(16-18-35)34-27(36)19-23(31(38)39)20-7-3-2-4-8-20/h2-14,22-23H,15-19H2,1H3,(H,34,36)(H,38,39) |
| InChIKey | VTSRCFJZNFQBNN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|