C17H19F3N2O3 — CID 108933035
2,2,2-trifluoro-N-[1-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]acetamide (PubChem CID 108933035) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108933035 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]acetamide |
| SMILES | COc1ccccc1/C=C/C(=O)N1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H19F3N2O3/c1-25-14-5-3-2-4-12(14)6-7-15(23)22-10-8-13(9-11-22)21-16(24)17(18,19)20/h2-7,13H,8-11H2,1H3,(H,21,24)/b7-6+ |
| InChIKey | QRCQTPJVYALYJA-VOTSOKGWSA-N |
| XLogP | 2.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|