C21H24F2N4O4 — CID 55749507
N-[1-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 55749507) has the molecular formula C21H24F2N4O4 and a molecular weight of 434.44 g/mol. Its IUPAC name is N-[1-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55749507 |
| Molecular Formula | C21H24F2N4O4 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[1-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1cccc(/C=C/C(=O)N2CCC(NC(=O)c3cnn(C)c3)CC2)c1OC(F)F |
| InChI | InChI=1S/C21H24F2N4O4/c1-26-13-15(12-24-26)20(29)25-16-8-10-27(11-9-16)18(28)7-6-14-4-3-5-17(30-2)19(14)31-21(22)23/h3-7,12-13,16,21H,8-11H2,1-2H3,(H,25,29)/b7-6+ |
| InChIKey | PUNBQKKICAWCNZ-VOTSOKGWSA-N |
| XLogP | 2.46 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|