C24H25F2NO5 — CID 41307867
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-methoxybenzoyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 41307867) has the molecular formula C24H25F2NO5 and a molecular weight of 445.46 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-methoxybenzoyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-methoxybenzoyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 41307867 |
| Molecular Formula | C24H25F2NO5 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-methoxybenzoyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)/C=C/c3cccc(OC)c3OC(F)F)CC2)cc1 |
| InChI | InChI=1S/C24H25F2NO5/c1-30-19-9-6-16(7-10-19)22(29)17-12-14-27(15-13-17)21(28)11-8-18-4-3-5-20(31-2)23(18)32-24(25)26/h3-11,17,24H,12-15H2,1-2H3/b11-8+ |
| InChIKey | XPGANHHRYJLOAN-DHZHZOJOSA-N |
| XLogP | 4.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|