C18H23NO5 — CID 108754985
methyl 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108754985) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108754985 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)/C=C/c2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C18H23NO5/c1-22-15-6-4-13(16(12-15)23-2)5-7-17(20)19-10-8-14(9-11-19)18(21)24-3/h4-7,12,14H,8-11H2,1-3H3/b7-5+ |
| InChIKey | CRTVKXIHNNHDRZ-FNORWQNLSA-N |
| XLogP | 2.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|