C17H19F4NO4 — CID 55483597
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-1-(4-methoxypiperidin-1-yl)prop-2-en-1-one (PubChem CID 55483597) has the molecular formula C17H19F4NO4 and a molecular weight of 377.33 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-1-(4-methoxypiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-1-(4-methoxypiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55483597 |
| Molecular Formula | C17H19F4NO4 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-1-(4-methoxypiperidin-1-yl)prop-2-en-1-one |
| SMILES | COC1CCN(C(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)CC1 |
| InChI | InChI=1S/C17H19F4NO4/c1-24-12-6-8-22(9-7-12)15(23)5-3-11-2-4-13(25-16(18)19)10-14(11)26-17(20)21/h2-5,10,12,16-17H,6-9H2,1H3/b5-3+ |
| InChIKey | HXTQZTLKCWHYCU-HWKANZROSA-N |
| XLogP | 3.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|