C21H24F2N4O6S — CID 24563487
4-[4-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide (PubChem CID 24563487) has the molecular formula C21H24F2N4O6S and a molecular weight of 498.51 g/mol. Its IUPAC name is 4-[4-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[4-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24563487 |
| Molecular Formula | C21H24F2N4O6S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 4-[4-[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide |
| SMILES | COc1cccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3cc(C(N)=O)n(C)c3)CC2)c1OC(F)F |
| InChI | InChI=1S/C21H24F2N4O6S/c1-25-13-15(12-16(25)20(24)29)34(30,31)27-10-8-26(9-11-27)18(28)7-6-14-4-3-5-17(32-2)19(14)33-21(22)23/h3-7,12-13,21H,8-11H2,1-2H3,(H2,24,29)/b7-6+ |
| InChIKey | NCSWKRUKVWYGQQ-VOTSOKGWSA-N |
| XLogP | 1.28 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|