C26H28Cl2F2N2O4S — CID 143445242
3-[[1-[(E)-3-[2,3-dichloro-4-(4-fluorophenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-2-fluoro-3-oxopropanoic acid;propane (PubChem CID 143445242) has the molecular formula C26H28Cl2F2N2O4S and a molecular weight of 573.49 g/mol. Its IUPAC name is 3-[[1-[(E)-3-[2,3-dichloro-4-(4-fluorophenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-2-fluoro-3-oxopropanoic acid;propane.
| Compound Name | 3-[[1-[(E)-3-[2,3-dichloro-4-(4-fluorophenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-2-fluoro-3-oxopropanoic acid;propane |
|---|---|
| PubChem CID | 143445242 |
| Molecular Formula | C26H28Cl2F2N2O4S |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 3-[[1-[(E)-3-[2,3-dichloro-4-(4-fluorophenyl)sulfanylphenyl]prop-2-enoyl]piperidin-4-yl]amino]-2-fluoro-3-oxopropanoic acid;propane |
| SMILES | CCC.O=C(O)C(F)C(=O)NC1CCN(C(=O)/C=C/c2ccc(Sc3ccc(F)cc3)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C23H20Cl2F2N2O4S.C3H8/c24-19-13(1-7-17(20(19)25)34-16-5-3-14(26)4-6-16)2-8-18(30)29-11-9-15(10-12-29)28-22(31)21(27)23(32)33;1-3-2/h1-8,15,21H,9-12H2,(H,28,31)(H,32,33);3H2,1-2H3/b8-2+; |
| InChIKey | KLUXSONLDOYDPG-VOKCZWNHSA-N |
| XLogP | 6.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|