C27H33Cl2N3O2S — CID 69450712
3-[2,3-dichloro-4-[3-[(1-propylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 69450712) has the molecular formula C27H33Cl2N3O2S and a molecular weight of 534.55 g/mol. Its IUPAC name is 3-[2,3-dichloro-4-[3-[(1-propylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[2,3-dichloro-4-[3-[(1-propylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 69450712 |
| Molecular Formula | C27H33Cl2N3O2S |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-[2,3-dichloro-4-[3-[(1-propylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | CCCN1CCC(Nc2cccc(Sc3ccc(C=CC(=O)N4CCOCC4)c(Cl)c3Cl)c2)CC1 |
| InChI | InChI=1S/C27H33Cl2N3O2S/c1-2-12-31-13-10-21(11-14-31)30-22-4-3-5-23(19-22)35-24-8-6-20(26(28)27(24)29)7-9-25(33)32-15-17-34-18-16-32/h3-9,19,21,30H,2,10-18H2,1H3 |
| InChIKey | NCFKZCWUKQYCIF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|