C25H27Cl2N3O4S — CID 20765588
2-[4-[3-[2,3-dichloro-4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperazin-1-yl]acetic acid (PubChem CID 20765588) has the molecular formula C25H27Cl2N3O4S and a molecular weight of 536.48 g/mol. Its IUPAC name is 2-[4-[3-[2,3-dichloro-4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-[2,3-dichloro-4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 20765588 |
| Molecular Formula | C25H27Cl2N3O4S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 2-[4-[3-[2,3-dichloro-4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2cccc(Sc3ccc(/C=C/C(=O)N4CCOCC4)c(Cl)c3Cl)c2)CC1 |
| InChI | InChI=1S/C25H27Cl2N3O4S/c26-24-18(5-7-22(31)30-12-14-34-15-13-30)4-6-21(25(24)27)35-20-3-1-2-19(16-20)29-10-8-28(9-11-29)17-23(32)33/h1-7,16H,8-15,17H2,(H,32,33)/b7-5+ |
| InChIKey | MSTNZPTWBFAMMW-FNORWQNLSA-N |
| XLogP | 4.22 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|