C22H20F6N2O4S2 — CID 59006897
N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]methanesulfonamide (PubChem CID 59006897) has the molecular formula C22H20F6N2O4S2 and a molecular weight of 554.53 g/mol. Its IUPAC name is N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]methanesulfonamide.
| Compound Name | N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59006897 |
| Molecular Formula | C22H20F6N2O4S2 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(Sc2ccc(/C=C/C(=O)N3CCOCC3)c(C(F)(F)F)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F6N2O4S2/c1-36(32,33)29-15-3-2-4-16(13-15)35-17-7-5-14(6-8-18(31)30-9-11-34-12-10-30)19(21(23,24)25)20(17)22(26,27)28/h2-8,13,29H,9-12H2,1H3/b8-6+ |
| InChIKey | WRAQYRXHSTXJFR-SOFGYWHQSA-N |
| XLogP | 5.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|