C26H27F6N3O2S2 — CID 59006719
1-butyl-3-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiourea (PubChem CID 59006719) has the molecular formula C26H27F6N3O2S2 and a molecular weight of 591.64 g/mol. Its IUPAC name is 1-butyl-3-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiourea.
| Compound Name | 1-butyl-3-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiourea |
|---|---|
| PubChem CID | 59006719 |
| Molecular Formula | C26H27F6N3O2S2 |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | 1-butyl-3-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiourea |
| SMILES | CCCCNC(=S)Nc1cccc(Sc2ccc(/C=C/C(=O)N3CCOCC3)c(C(F)(F)F)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F6N3O2S2/c1-2-3-11-33-24(38)34-18-5-4-6-19(16-18)39-20-9-7-17(8-10-21(36)35-12-14-37-15-13-35)22(25(27,28)29)23(20)26(30,31)32/h4-10,16H,2-3,11-15H2,1H3,(H2,33,34,38)/b10-8+ |
| InChIKey | WDHVJJSITILTDM-CSKARUKUSA-N |
| XLogP | 6.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|