C24H22F6N2O4S — CID 59006725
ethyl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate (PubChem CID 59006725) has the molecular formula C24H22F6N2O4S and a molecular weight of 548.51 g/mol. Its IUPAC name is ethyl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate.
| Compound Name | ethyl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 59006725 |
| Molecular Formula | C24H22F6N2O4S |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | ethyl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Sc2ccc(/C=C/C(=O)N3CCOCC3)c(C(F)(F)F)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F6N2O4S/c1-2-36-22(34)31-16-4-3-5-17(14-16)37-18-8-6-15(7-9-19(33)32-10-12-35-13-11-32)20(23(25,26)27)21(18)24(28,29)30/h3-9,14H,2,10-13H2,1H3,(H,31,34)/b9-7+ |
| InChIKey | ILLWLDPPQIIIRY-VQHVLOKHSA-N |
| XLogP | 6.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|