C25H20F6N2O4S3 — CID 59006861
N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiophene-3-sulfonamide (PubChem CID 59006861) has the molecular formula C25H20F6N2O4S3 and a molecular weight of 622.63 g/mol. Its IUPAC name is N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiophene-3-sulfonamide.
| Compound Name | N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 59006861 |
| Molecular Formula | C25H20F6N2O4S3 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]thiophene-3-sulfonamide |
| SMILES | O=C(/C=C/c1ccc(Sc2cccc(NS(=O)(=O)c3ccsc3)c2)c(C(F)(F)F)c1C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C25H20F6N2O4S3/c26-24(27,28)22-16(5-7-21(34)33-9-11-37-12-10-33)4-6-20(23(22)25(29,30)31)39-18-3-1-2-17(14-18)32-40(35,36)19-8-13-38-15-19/h1-8,13-15,32H,9-12H2/b7-5+ |
| InChIKey | OMMRGFWRTZTRLU-FNORWQNLSA-N |
| XLogP | 6.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|