C23H20F6N2O4S — CID 59808236
2-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylanilino]acetic acid (PubChem CID 59808236) has the molecular formula C23H20F6N2O4S and a molecular weight of 534.48 g/mol. Its IUPAC name is 2-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylanilino]acetic acid.
| Compound Name | 2-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylanilino]acetic acid |
|---|---|
| PubChem CID | 59808236 |
| Molecular Formula | C23H20F6N2O4S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 2-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylanilino]acetic acid |
| SMILES | O=C(O)CNc1cccc(Sc2ccc(/C=C/C(=O)N3CCOCC3)c(C(F)(F)F)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F6N2O4S/c24-22(25,26)20-14(5-7-18(32)31-8-10-35-11-9-31)4-6-17(21(20)23(27,28)29)36-16-3-1-2-15(12-16)30-13-19(33)34/h1-7,12,30H,8-11,13H2,(H,33,34)/b7-5+ |
| InChIKey | WKQBANDJUDCIQG-FNORWQNLSA-N |
| XLogP | 5.24 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|