C25H24F6N2O4S — CID 59006905
propan-2-yl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate (PubChem CID 59006905) has the molecular formula C25H24F6N2O4S and a molecular weight of 562.53 g/mol. Its IUPAC name is propan-2-yl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate.
| Compound Name | propan-2-yl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 59006905 |
| Molecular Formula | C25H24F6N2O4S |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | propan-2-yl N-[3-[4-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]carbamate |
| SMILES | CC(C)OC(=O)Nc1cccc(Sc2ccc(/C=C/C(=O)N3CCOCC3)c(C(F)(F)F)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F6N2O4S/c1-15(2)37-23(35)32-17-4-3-5-18(14-17)38-19-8-6-16(7-9-20(34)33-10-12-36-13-11-33)21(24(26,27)28)22(19)25(29,30)31/h3-9,14-15H,10-13H2,1-2H3,(H,32,35)/b9-7+ |
| InChIKey | VDTPCAUUCSCTRK-VQHVLOKHSA-N |
| XLogP | 6.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|