C27H23F6N3O2S — CID 72567342
1-morpholin-4-yl-3-[4-[3-(pyridin-3-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 72567342) has the molecular formula C27H23F6N3O2S and a molecular weight of 567.56 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-[4-[3-(pyridin-3-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-morpholin-4-yl-3-[4-[3-(pyridin-3-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72567342 |
| Molecular Formula | C27H23F6N3O2S |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 1-morpholin-4-yl-3-[4-[3-(pyridin-3-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Sc2cccc(NCc3cccnc3)c2)c(C(F)(F)F)c1C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C27H23F6N3O2S/c28-26(29,30)24-19(7-9-23(37)36-11-13-38-14-12-36)6-8-22(25(24)27(31,32)33)39-21-5-1-4-20(15-21)35-17-18-3-2-10-34-16-18/h1-10,15-16,35H,11-14,17H2 |
| InChIKey | XAJQMAMBZVMSQG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|