C27H21F6N3O6S2 — CID 73030003
N-[3-[4-(3-morpholin-4-yl-3-oxoprop-1-enyl)-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]-3-nitrobenzenesulfonamide (PubChem CID 73030003) has the molecular formula C27H21F6N3O6S2 and a molecular weight of 661.60 g/mol. Its IUPAC name is N-[3-[4-(3-morpholin-4-yl-3-oxoprop-1-enyl)-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[3-[4-(3-morpholin-4-yl-3-oxoprop-1-enyl)-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 73030003 |
| Molecular Formula | C27H21F6N3O6S2 |
| Molecular Weight | 661.60 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | N-[3-[4-(3-morpholin-4-yl-3-oxoprop-1-enyl)-2,3-bis(trifluoromethyl)phenyl]sulfanylphenyl]-3-nitrobenzenesulfonamide |
| SMILES | O=C(C=Cc1ccc(Sc2cccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)c2)c(C(F)(F)F)c1C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C27H21F6N3O6S2/c28-26(29,30)24-17(8-10-23(37)35-11-13-42-14-12-35)7-9-22(25(24)27(31,32)33)43-20-5-1-3-18(15-20)34-44(40,41)21-6-2-4-19(16-21)36(38)39/h1-10,15-16,34H,11-14H2 |
| InChIKey | AZLPKSIETFKELT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|